Triazophos - CAS 24017-47-8

Triazophos is a non-systemic pesticide that acts as an acetylcholinesterase (AChE) inhibitor, forming a covalent and irreversible bond with the acetylcholine binding site. This action blocks the hydrolysis of acetylcholine, leading to increased excitability. It is effective against a wide range of soil insects and mites, including aphids, thrips, midges, beetles, lepidopteran larvae, mole crickets, and red spiders. Triazophos is suitable for use on various crops such as ornamental plants, cotton, rice, corn, soybeans, oil palm, olives, and coffee.

Cholinesterase (ChE), Parasite, Others

Others, Microbiology/Virology, Neuroscience

23962

C12H16N3O3PS

313.31

S=P(OC=1N=CN(N1)C=2C=CC=CC2)(OCC)OCC

-20°C

Ice Packs

Small Compound