Trimethyloctylammonium bromide - CAS 2083-68-3

Trimethyloctylammonium bromide (TOAB) acts as a surfactant and phase-transfer catalyst in various chemical reactions. It is employed in the synthesis of nanomaterials for its ability to selectively transfer ions across interfaces, and serves as a surfactant in emulsion and foam production. Its amphiphilic nature is valued for interacting with water and oil, stabilizing, and dispersing mixtures.

2083-68-3

C11H26BrN

252.23

[Br-].CCCCCCCC[N+](C)(C)C

-20°C

Ice Packs

Inhibitors & Agonists