Trimethylphenylammonium bromide - CAS 16056-11-4

Trimethylphenylammonium bromide is a quaternary ammonium salt comprised of a positively charged N, N, N-trimethylphenylamine cation and a negatively charged bromide anion. This compound is commonly employed as a phase transfer catalyst in organic reactions, facilitating the movement of reactants between immiscible phases. It also serves as a reagent in the synthesis of various organic compounds and can be used as a surfactant or corrosion inhibitor in certain applications.

16056-11-4

C9H14BrN

216.12

[Br-].C=1C=CC(=CC1)[N+](C)(C)C

-20°C

Ice Packs

Inhibitors & Agonists