TRK-IN-32 - CAS 3044124-79-7

TRK-IN-32 is a potent TRK inhibitor. It significantly suppresses TRKWT, TRKG595R, and TRKG667C with IC50 values of 0.08 nM, 2.14 nM, and 0.68 nM, respectively. Additionally, TRK-IN-32 exhibits antiproliferative activity against various Ba/F3 cell lines transformed by wild-type, xDFG mutant, solvent front, and gatekeeper mutant TRK fusion proteins. It also induces apoptosis in Ba/F3-TRKAWT and Ba/F3-TRKAG667C cells. TRK-IN-32 is applicable in research on various cancers, including thyroid cancer and secretory breast cancer.

Apoptosis, Trk receptor

Tyrosine Kinase/Adaptors, Apoptosis

3044038

C19H18FN7

363.39

N([C@@H](C)C1=CC=C(F)C=N1)C2=NN3C(=CN=C3C=C2)C4=CC(=NN4)C5CC5

-20°C

Ice Packs

Small Compound