Tuaminoheptane sulfate - CAS 6411-75-2

Tuaminoheptane was originally developed as a nasal decongestant and belongs to the class of sympathomimetics and vasoconstrictors. It exhibits decongestant and stimulating effects by inhibiting and releasing norepinephrine. Unlike phenethylamine-based norepinephrine releasers, Tuaminoheptane has a unique chemical structure. Additionally, it may cause contact dermatitis due to its potential to irritate the skin by inhibiting volume-regulated anion channels, which limits its effectiveness as a decongestant.

6334

C7H17N 1/2H2O4S

164.26

NC(CCCCC)C.O=S(O)(O)=O.NC(CCCCC)C

-20°C

Ice Packs

Small Compound