Tubulin/HDAC-IN-1 - CAS 2413587-26-3

Tubulin/HDAC-IN-1 is a dual inhibitor of tubulin and HDAC8, interacting with tubulin via CH/π interactions and with HDAC8 through hydrogen bonds. It effectively inhibits tubulin polymerization and selectively targets HDAC8 with an IC50 of 150 nM. Additionally, Tubulin/HDAC-IN-1 demonstrates cytotoxicity against various human cancer cells, induces cell cycle arrest in the G2/M phase, and triggers cell apoptosis, making it valuable for studying hematologic and solid tumors, including neuroblastoma and leukemia [1].

HDAC, Others, Apoptosis, Mitochondrial Metabolism, Microtubule Associated

Apoptosis, Others, Chromatin/Epigenetic, Cytoskeletal Signaling, DNA Damage/DNA Repair, Metabolism

2413558

C21H18N4O3

374.39

N(C)(C=1C2=C(N=C(C#N)C1)C=CC=C2)C3=CC(/C=C/C(NO)=O)=C(OC)C=C3

-20°C

Ice Packs

Small Compound