Uridine triphosphate 13C9,15N2 sodium - CAS 285978-18-9

Uridine triphosphate 13C9,15N2 sodium is an isotopically labeled Uridine triphosphate sodium that can be used for isotope tracing.Uridine triphosphate (UTP) is a key in RNA synthesis molecule that serves as a substrate for RNA polymerase during transcription.

Nucleoside Antimetabolite/Analog, DNA/RNA Synthesis

Cell Cycle/Checkpoint, DNA Damage/DNA Repair

285951

13C9 H14 15N2 NaO15P3

517.04

O[13C@H]1[13C@H]([15N]2[13C]([15NH][13C]([13CH]=[13CH]2)=O)=O)O[13C@@H]([13C@H]1O)[13CH2]OP(OP(OP([O-])(O)=O)(O)=O)(O)=O.[Na+]

-20°C

Ice Packs

Isotope products