Vicanicin - CAS 33211-22-2

Vicanicin is an aryl phenol ether compound found in lichens. It inhibits the expression of Hsp70, modulates intracellular redox-sensitive mechanisms, increases reactive oxygen species (ROS) in cancer cells, alters the Bax/Bcl-2 ratio, activates caspase-3, and induces apoptosis. Vicanicin suppresses cell growth and promotes apoptosis in androgen-sensitive (LNCaP) and androgen-insensitive (DU-145) human prostate cancer cells. It holds potential for prostate cancer research.

Apoptosis, HSP, Reactive Oxygen Species, Caspase

Immunology/Inflammation, Apoptosis, NF-κB, Cytoskeletal Signaling, Proteases/Proteasome, Metabolism

33211-22-2

C18H16Cl2O5

383.223

O=C1OC2=C(OC3=C1C(=C(Cl)C(O)=C3C)C)C(=C(Cl)C(OC)=C2C)C

-20°C

Ice Packs

Natural Product