VS1150 - CAS 2855238-97-8

VS1150 (Compound 11) is a phosphorylation-inducing chimeric small molecule (PHICS) designed to target BCR-ABL. It effectively hinders oncogenic kinase BCR-ABL signaling through inhibitory phosphorylation at the Y253 site (EC50: 69 nM), leading to apoptosis. Additionally, VS1150 can inhibit other oncogenic ABL fusion proteins and resistant mutants, such as T315I. This compound is applicable in research on chronic myeloid leukemia (CML) and other cancers driven by ABL fusion proteins.

Caspase, PARP, Apoptosis, STAT, ERK, Bcr-Abl

Cytoskeletal Signaling, Chromatin/Epigenetic, Tyrosine Kinase/Adaptors, Proteases/Proteasome, Apoptosis, MAPK, Stem Cells, JAK/STAT signaling, DNA Damage/DNA Repair, Angiogenesis

2855133

C36H38Cl4N12O4

844.58

O=C(NC1=NN(C2=CC=C(Cl)C(Cl)=C2)CC1)C3=CN=C(N=C3C)NCCOCCOCCNC4=NC=C(C(=O)NC5=NN(C6=CC=C(Cl)C(Cl)=C6)CC5)C(=N4)C

-20°C

Ice Packs

Small Compound