YSY01A - CAS 1194235-46-5

YSY01A is a proteasome inhibitor that suppresses cancer cell survival by inducing apoptosis (Apoptosis) . It demonstrates IC50 values against various cell lines such as HEK293T, A549, MCF-7, MGC-803, and PC-3M with values of 51.01, 9.21, 5.21, 8.9, and 35.4 nM respectively. Additionally, YSY01A serves as a degrader of gp130 and JAK2, eliminating constitutive STAT3 signaling in human A549 lung cancer cells by downregulating gp130 and JAK2. YSY01A holds potential for research in cancer therapeutics.

STAT, JAK, Proteasome, Interleukin

Stem Cells, Proteases/Proteasome, Angiogenesis, Immunology/Inflammation, JAK/STAT signaling, Tyrosine Kinase/Adaptors, Ubiquitination, Chromatin/Epigenetic

1194184

C29H38BN5O5

547.45

C([C@H](NC([C@@H](NC(=O)C=1C=NC=CN1)CC(C)C)=O)C(N[C@@H](CC(C)C)B(O)O)=O)C2=CC3=C(C=C2)C=CC=C3

-20°C

Ice Packs

Small Compound