Zeteletinib hemiadipate - CAS 2375837-06-0

Zeteletinib hemiadipate (BOS-172738; DS-5010) is an orally active compound that functions as a selective inhibitor of RET kinase. It exhibits nanomolar potency against RET and a 300-fold selectivity towards VEGFR2. Notably, Zeteletinib hemiadipate demonstrates exceptional effectiveness against various forms of RET, including the wild type, RET V804M/L gatekeeper mutants, and the oncogenic RET mutation M918T. Additionally, Zeteletinib hemiadipate exerts potent antitumor effects.

C-RET, Others, PDGFR

Angiogenesis, Tyrosine Kinase/Adaptors, Apoptosis, Others

2375837-06-0

C56H56F6N8O12

1147.098

OC(=O)CCCCC(O)=O.COc1cc2cc(cnc2cc1OC)-c1ccc(CC(=O)Nc2cc(no2)C(C)(C)C(F)(F)F)cn1.COc1cc2cc(cnc2cc1OC)-c1ccc(CC(=O)Nc2cc(no2)C(C)(C)C(F)(F)F)cn1

-20°C

Ice Packs

Small Compound